About barium(2+);bis(2-methoxyacetate)
barium(2+);bis(2-methoxyacetate) (PubChem CID 88657250) has the molecular formula C6H10BaO6
and a molecular weight of 315.47 g/mol. Its IUPAC name is barium(2+);bis(2-methoxyacetate).
Molecular Properties
| Compound Name | barium(2+);bis(2-methoxyacetate) |
| PubChem CID | 88657250 |
| Molecular Formula | C6H10BaO6 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | barium(2+);bis(2-methoxyacetate) |
| SMILES | COCC(=O)[O-].COCC(=O)[O-].[Ba+2] |
| InChI | InChI=1S/2C3H6O3.Ba/c2*1-6-2-3(4)5;/h2*2H2,1H3,(H,4,5);/q;;+2/p-2 |
| InChIKey | NGNAYFCJZFELCJ-UHFFFAOYSA-L |
| XLogP | -3.62 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze barium(2+);bis(2-methoxyacetate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(2-methoxyacetate)?
The IUPAC name of barium(2+);bis(2-methoxyacetate) (CID 88657250) is barium(2+);bis(2-methoxyacetate).
What is the SMILES notation for barium(2+);bis(2-methoxyacetate)?
The canonical SMILES for barium(2+);bis(2-methoxyacetate) is COCC(=O)[O-].COCC(=O)[O-].[Ba+2].
What is the InChIKey of barium(2+);bis(2-methoxyacetate)?
The InChIKey is NGNAYFCJZFELCJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H6O3.Ba/c2*1-6-2-3(4)5;/h2*2H2,1H3,(H,4,5);/q;;+2/p-2.
What are the key properties of barium(2+);bis(2-methoxyacetate)?
barium(2+);bis(2-methoxyacetate) has a molecular weight of 315.47 g/mol, XLogP of -3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(2-methoxyacetate) is sourced from PubChem (CID 88657250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).