C12H27O5P — CID 118645024
ethyl-[2-(2-methoxyethoxy)ethyl]-dimethylphosphanium;2-methoxyacetate (PubChem CID 118645024) has the molecular formula C12H27O5P and a molecular weight of 282.32 g/mol. Its IUPAC name is ethyl-[2-(2-methoxyethoxy)ethyl]-dimethylphosphanium;2-methoxyacetate.
| Compound Name | ethyl-[2-(2-methoxyethoxy)ethyl]-dimethylphosphanium;2-methoxyacetate |
|---|---|
| PubChem CID | 118645024 |
| Molecular Formula | C12H27O5P |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | ethyl-[2-(2-methoxyethoxy)ethyl]-dimethylphosphanium;2-methoxyacetate |
| SMILES | CC[P+](C)(C)CCOCCOC.COCC(=O)[O-] |
| InChI | InChI=1S/C9H22O2P.C3H6O3/c1-5-12(3,4)9-8-11-7-6-10-2;1-6-2-3(4)5/h5-9H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | MSQDKRVNFWMIGR-UHFFFAOYSA-M |
| XLogP | 0.33 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|