C18H39O8P — CID 118645311
bis(2-methoxyethyl)-dimethylphosphanium;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate (PubChem CID 118645311) has the molecular formula C18H39O8P and a molecular weight of 414.48 g/mol. Its IUPAC name is bis(2-methoxyethyl)-dimethylphosphanium;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate.
| Compound Name | bis(2-methoxyethyl)-dimethylphosphanium;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 118645311 |
| Molecular Formula | C18H39O8P |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | bis(2-methoxyethyl)-dimethylphosphanium;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate |
| SMILES | COCCOCCOCCOCCC(=O)[O-].COCC[P+](C)(C)CCOC |
| InChI | InChI=1S/C10H20O6.C8H20O2P/c1-13-4-5-15-8-9-16-7-6-14-3-2-10(11)12;1-9-5-7-11(3,4)8-6-10-2/h2-9H2,1H3,(H,11,12);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | BUYCNDMVXLKTLC-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|