C10H23O3PS — CID 118645178
2-methoxyethyl(trimethyl)phosphanium;3-methylsulfanylpropanoate (PubChem CID 118645178) has the molecular formula C10H23O3PS and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-methoxyethyl(trimethyl)phosphanium;3-methylsulfanylpropanoate.
| Compound Name | 2-methoxyethyl(trimethyl)phosphanium;3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 118645178 |
| Molecular Formula | C10H23O3PS |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-methoxyethyl(trimethyl)phosphanium;3-methylsulfanylpropanoate |
| SMILES | COCC[P+](C)(C)C.CSCCC(=O)[O-] |
| InChI | InChI=1S/C6H16OP.C4H8O2S/c1-7-5-6-8(2,3)4;1-7-3-2-4(5)6/h5-6H2,1-4H3;2-3H2,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | RTWAOVNAZIXMDX-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|