C13H29O4PS — CID 118645462
ethyl-[2-(2-methoxyethoxy)ethyl]-dimethylphosphanium;3-methylsulfanylpropanoate (PubChem CID 118645462) has the molecular formula C13H29O4PS and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl-[2-(2-methoxyethoxy)ethyl]-dimethylphosphanium;3-methylsulfanylpropanoate.
| Compound Name | ethyl-[2-(2-methoxyethoxy)ethyl]-dimethylphosphanium;3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 118645462 |
| Molecular Formula | C13H29O4PS |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | ethyl-[2-(2-methoxyethoxy)ethyl]-dimethylphosphanium;3-methylsulfanylpropanoate |
| SMILES | CC[P+](C)(C)CCOCCOC.CSCCC(=O)[O-] |
| InChI | InChI=1S/C9H22O2P.C4H8O2S/c1-5-12(3,4)9-8-11-7-6-10-2;1-7-3-2-4(5)6/h5-9H2,1-4H3;2-3H2,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | SSWXHFWZQACLIF-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|