C18H39NO4 — CID 118645219
3-(2-methoxyethoxy)propanoate;tetrapropylazanium (PubChem CID 118645219) has the molecular formula C18H39NO4 and a molecular weight of 333.51 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)propanoate;tetrapropylazanium.
| Compound Name | 3-(2-methoxyethoxy)propanoate;tetrapropylazanium |
|---|---|
| PubChem CID | 118645219 |
| Molecular Formula | C18H39NO4 |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 333.29 |
| IUPAC Name | 3-(2-methoxyethoxy)propanoate;tetrapropylazanium |
| SMILES | CCC[N+](CCC)(CCC)CCC.COCCOCCC(=O)[O-] |
| InChI | InChI=1S/C12H28N.C6H12O4/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-9-4-5-10-3-2-6(7)8/h5-12H2,1-4H3;2-5H2,1H3,(H,7,8)/q+1;/p-1 |
| InChIKey | HBRLKRCORAZICF-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|