C18H39NO7 — CID 118645288
bis(2-ethoxyethyl)-dimethylazanium;3-[2-(2-methoxyethoxy)ethoxy]propanoate (PubChem CID 118645288) has the molecular formula C18H39NO7 and a molecular weight of 381.51 g/mol. Its IUPAC name is bis(2-ethoxyethyl)-dimethylazanium;3-[2-(2-methoxyethoxy)ethoxy]propanoate.
| Compound Name | bis(2-ethoxyethyl)-dimethylazanium;3-[2-(2-methoxyethoxy)ethoxy]propanoate |
|---|---|
| PubChem CID | 118645288 |
| Molecular Formula | C18H39NO7 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | bis(2-ethoxyethyl)-dimethylazanium;3-[2-(2-methoxyethoxy)ethoxy]propanoate |
| SMILES | CCOCC[N+](C)(C)CCOCC.COCCOCCOCCC(=O)[O-] |
| InChI | InChI=1S/C10H24NO2.C8H16O5/c1-5-12-9-7-11(3,4)8-10-13-6-2;1-11-4-5-13-7-6-12-3-2-8(9)10/h5-10H2,1-4H3;2-7H2,1H3,(H,9,10)/q+1;/p-1 |
| InChIKey | VWOROCKKOAZGSV-UHFFFAOYSA-M |
| XLogP | -0.06 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|