C17H40N2O7 — CID 87147133
bis(bis(2-methoxyethyl)-dimethylazanium);carbonate (PubChem CID 87147133) has the molecular formula C17H40N2O7 and a molecular weight of 384.51 g/mol. Its IUPAC name is bis(bis(2-methoxyethyl)-dimethylazanium);carbonate.
| Compound Name | bis(bis(2-methoxyethyl)-dimethylazanium);carbonate |
|---|---|
| PubChem CID | 87147133 |
| Molecular Formula | C17H40N2O7 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | bis(bis(2-methoxyethyl)-dimethylazanium);carbonate |
| SMILES | COCC[N+](C)(C)CCOC.COCC[N+](C)(C)CCOC.O=C([O-])[O-] |
| InChI | InChI=1S/2C8H20NO2.CH2O3/c2*1-9(2,5-7-10-3)6-8-11-4;2-1(3)4/h2*5-8H2,1-4H3;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | MSUGANPLTUMLSQ-UHFFFAOYSA-L |
| XLogP | -1.74 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|