About bis(2-methoxyethyl)-dimethylazanium;methyl carbonate
bis(2-methoxyethyl)-dimethylazanium;methyl carbonate (PubChem CID 167445577) has the molecular formula C10H23NO5
and a molecular weight of 237.30 g/mol. Its IUPAC name is bis(2-methoxyethyl)-dimethylazanium;methyl carbonate.
Molecular Properties
| Compound Name | bis(2-methoxyethyl)-dimethylazanium;methyl carbonate |
| PubChem CID | 167445577 |
| Molecular Formula | C10H23NO5 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | bis(2-methoxyethyl)-dimethylazanium;methyl carbonate |
| SMILES | COC(=O)[O-].COCC[N+](C)(C)CCOC |
| InChI | InChI=1S/C8H20NO2.C2H4O3/c1-9(2,5-7-10-3)6-8-11-4;1-5-2(3)4/h5-8H2,1-4H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | KGDIEFASAQHDFB-UHFFFAOYSA-M |
| XLogP | -0.67 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methoxyethyl)-dimethylazanium;methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methoxyethyl)-dimethylazanium;methyl carbonate?
The IUPAC name of bis(2-methoxyethyl)-dimethylazanium;methyl carbonate (CID 167445577) is bis(2-methoxyethyl)-dimethylazanium;methyl carbonate.
What is the SMILES notation for bis(2-methoxyethyl)-dimethylazanium;methyl carbonate?
The canonical SMILES for bis(2-methoxyethyl)-dimethylazanium;methyl carbonate is COC(=O)[O-].COCC[N+](C)(C)CCOC.
What is the InChIKey of bis(2-methoxyethyl)-dimethylazanium;methyl carbonate?
The InChIKey is KGDIEFASAQHDFB-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20NO2.C2H4O3/c1-9(2,5-7-10-3)6-8-11-4;1-5-2(3)4/h5-8H2,1-4H3;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of bis(2-methoxyethyl)-dimethylazanium;methyl carbonate?
bis(2-methoxyethyl)-dimethylazanium;methyl carbonate has a molecular weight of 237.30 g/mol, XLogP of -0.67, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methoxyethyl)-dimethylazanium;methyl carbonate is sourced from PubChem (CID 167445577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).