About dimethyl(dioctyl)azanium;methyl carbonate
dimethyl(dioctyl)azanium;methyl carbonate (PubChem CID 160720913) has the molecular formula C20H43NO3
and a molecular weight of 345.57 g/mol. Its IUPAC name is dimethyl(dioctyl)azanium;methyl carbonate.
Molecular Properties
| Compound Name | dimethyl(dioctyl)azanium;methyl carbonate |
| PubChem CID | 160720913 |
| Molecular Formula | C20H43NO3 |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.32 |
| IUPAC Name | dimethyl(dioctyl)azanium;methyl carbonate |
| SMILES | CCCCCCCC[N+](C)(C)CCCCCCCC.COC(=O)[O-] |
| InChI | InChI=1S/C18H40N.C2H4O3/c1-5-7-9-11-13-15-17-19(3,4)18-16-14-12-10-8-6-2;1-5-2(3)4/h5-18H2,1-4H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | RTBYHMBKERYCIA-UHFFFAOYSA-M |
| XLogP | 4.76 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(dioctyl)azanium;methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(dioctyl)azanium;methyl carbonate?
The IUPAC name of dimethyl(dioctyl)azanium;methyl carbonate (CID 160720913) is dimethyl(dioctyl)azanium;methyl carbonate.
What is the SMILES notation for dimethyl(dioctyl)azanium;methyl carbonate?
The canonical SMILES for dimethyl(dioctyl)azanium;methyl carbonate is CCCCCCCC[N+](C)(C)CCCCCCCC.COC(=O)[O-].
What is the InChIKey of dimethyl(dioctyl)azanium;methyl carbonate?
The InChIKey is RTBYHMBKERYCIA-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H40N.C2H4O3/c1-5-7-9-11-13-15-17-19(3,4)18-16-14-12-10-8-6-2;1-5-2(3)4/h5-18H2,1-4H3;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of dimethyl(dioctyl)azanium;methyl carbonate?
dimethyl(dioctyl)azanium;methyl carbonate has a molecular weight of 345.57 g/mol, XLogP of 4.76, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(dioctyl)azanium;methyl carbonate is sourced from PubChem (CID 160720913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).