About butanoate;didecyl(dimethyl)azanium
butanoate;didecyl(dimethyl)azanium (PubChem CID 175270974) has the molecular formula C26H55NO2
and a molecular weight of 413.73 g/mol. Its IUPAC name is butanoate;didecyl(dimethyl)azanium.
Molecular Properties
| Compound Name | butanoate;didecyl(dimethyl)azanium |
| PubChem CID | 175270974 |
| Molecular Formula | C26H55NO2 |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 413.42 |
| IUPAC Name | butanoate;didecyl(dimethyl)azanium |
| SMILES | CCCC(=O)[O-].CCCCCCCCCC[N+](C)(C)CCCCCCCCCC |
| InChI | InChI=1S/C22H48N.C4H8O2/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;1-2-3-4(5)6/h5-22H2,1-4H3;2-3H2,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | NTNWNMCKEQZWGR-UHFFFAOYSA-M |
| XLogP | 6.88 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butanoate;didecyl(dimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;didecyl(dimethyl)azanium?
The IUPAC name of butanoate;didecyl(dimethyl)azanium (CID 175270974) is butanoate;didecyl(dimethyl)azanium.
What is the SMILES notation for butanoate;didecyl(dimethyl)azanium?
The canonical SMILES for butanoate;didecyl(dimethyl)azanium is CCCC(=O)[O-].CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.
What is the InChIKey of butanoate;didecyl(dimethyl)azanium?
The InChIKey is NTNWNMCKEQZWGR-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H48N.C4H8O2/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;1-2-3-4(5)6/h5-22H2,1-4H3;2-3H2,1H3,(H,5,6)/q+1;/p-1.
What are the key properties of butanoate;didecyl(dimethyl)azanium?
butanoate;didecyl(dimethyl)azanium has a molecular weight of 413.73 g/mol, XLogP of 6.88, 20 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;didecyl(dimethyl)azanium is sourced from PubChem (CID 175270974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).