About didecyl(dimethyl)azanium;ethyl carbonate
didecyl(dimethyl)azanium;ethyl carbonate (PubChem CID 22256010) has the molecular formula C25H53NO3
and a molecular weight of 415.70 g/mol. Its IUPAC name is didecyl(dimethyl)azanium;ethyl carbonate.
Molecular Properties
| Compound Name | didecyl(dimethyl)azanium;ethyl carbonate |
| PubChem CID | 22256010 |
| Molecular Formula | C25H53NO3 |
| Molecular Weight | 415.70 g/mol |
| Exact Mass | 415.40 |
| IUPAC Name | didecyl(dimethyl)azanium;ethyl carbonate |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.CCOC(=O)[O-] |
| InChI | InChI=1S/C22H48N.C3H6O3/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;1-2-6-3(4)5/h5-22H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | BLIGBYQXQRWDPQ-UHFFFAOYSA-M |
| XLogP | 6.71 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.70 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze didecyl(dimethyl)azanium;ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl(dimethyl)azanium;ethyl carbonate?
The IUPAC name of didecyl(dimethyl)azanium;ethyl carbonate (CID 22256010) is didecyl(dimethyl)azanium;ethyl carbonate.
What is the SMILES notation for didecyl(dimethyl)azanium;ethyl carbonate?
The canonical SMILES for didecyl(dimethyl)azanium;ethyl carbonate is CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.CCOC(=O)[O-].
What is the InChIKey of didecyl(dimethyl)azanium;ethyl carbonate?
The InChIKey is BLIGBYQXQRWDPQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H48N.C3H6O3/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;1-2-6-3(4)5/h5-22H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1.
What are the key properties of didecyl(dimethyl)azanium;ethyl carbonate?
didecyl(dimethyl)azanium;ethyl carbonate has a molecular weight of 415.70 g/mol, XLogP of 6.71, 19 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl(dimethyl)azanium;ethyl carbonate is sourced from PubChem (CID 22256010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).