About 3-methoxy-3-oxopropanoate;tetrapropylazanium
3-methoxy-3-oxopropanoate;tetrapropylazanium (PubChem CID 159144193) has the molecular formula C16H33NO4
and a molecular weight of 303.44 g/mol. Its IUPAC name is 3-methoxy-3-oxopropanoate;tetrapropylazanium.
Molecular Properties
| Compound Name | 3-methoxy-3-oxopropanoate;tetrapropylazanium |
| PubChem CID | 159144193 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 3-methoxy-3-oxopropanoate;tetrapropylazanium |
| SMILES | CCC[N+](CCC)(CCC)CCC.COC(=O)CC(=O)[O-] |
| InChI | InChI=1S/C12H28N.C4H6O4/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-8-4(7)2-3(5)6/h5-12H2,1-4H3;2H2,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | KILWRHWUGCWQNC-UHFFFAOYSA-M |
| XLogP | 1.74 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-3-oxopropanoate;tetrapropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-3-oxopropanoate;tetrapropylazanium?
The IUPAC name of 3-methoxy-3-oxopropanoate;tetrapropylazanium (CID 159144193) is 3-methoxy-3-oxopropanoate;tetrapropylazanium.
What is the SMILES notation for 3-methoxy-3-oxopropanoate;tetrapropylazanium?
The canonical SMILES for 3-methoxy-3-oxopropanoate;tetrapropylazanium is CCC[N+](CCC)(CCC)CCC.COC(=O)CC(=O)[O-].
What is the InChIKey of 3-methoxy-3-oxopropanoate;tetrapropylazanium?
The InChIKey is KILWRHWUGCWQNC-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28N.C4H6O4/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-8-4(7)2-3(5)6/h5-12H2,1-4H3;2H2,1H3,(H,5,6)/q+1;/p-1.
What are the key properties of 3-methoxy-3-oxopropanoate;tetrapropylazanium?
3-methoxy-3-oxopropanoate;tetrapropylazanium has a molecular weight of 303.44 g/mol, XLogP of 1.74, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-3-oxopropanoate;tetrapropylazanium is sourced from PubChem (CID 159144193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).