About antimony(3+);tetrapropylazanium
antimony(3+);tetrapropylazanium (PubChem CID 18954503) has the molecular formula C12H28NSb+4
and a molecular weight of 308.12 g/mol. Its IUPAC name is antimony(3+);tetrapropylazanium.
Molecular Properties
| Compound Name | antimony(3+);tetrapropylazanium |
| PubChem CID | 18954503 |
| Molecular Formula | C12H28NSb+4 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | antimony(3+);tetrapropylazanium |
| SMILES | CCC[N+](CCC)(CCC)CCC.[Sb+3] |
| InChI | InChI=1S/C12H28N.Sb/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;/q+1;+3 |
| InChIKey | TYJHOKBGUCFEMM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze antimony(3+);tetrapropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of antimony(3+);tetrapropylazanium?
The IUPAC name of antimony(3+);tetrapropylazanium (CID 18954503) is antimony(3+);tetrapropylazanium.
What is the SMILES notation for antimony(3+);tetrapropylazanium?
The canonical SMILES for antimony(3+);tetrapropylazanium is CCC[N+](CCC)(CCC)CCC.[Sb+3].
What is the InChIKey of antimony(3+);tetrapropylazanium?
The InChIKey is TYJHOKBGUCFEMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N.Sb/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;/q+1;+3.
What are the key properties of antimony(3+);tetrapropylazanium?
antimony(3+);tetrapropylazanium has a molecular weight of 308.12 g/mol, XLogP of 3.06, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for antimony(3+);tetrapropylazanium is sourced from PubChem (CID 18954503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).