About tetrapropylazanium periodate
tetrapropylazanium periodate (PubChem CID 3020483) has the molecular formula C12H28INO4
and a molecular weight of 377.26 g/mol. Its IUPAC name is tetrapropylazanium periodate.
Molecular Properties
| Compound Name | tetrapropylazanium periodate |
| PubChem CID | 3020483 |
| Molecular Formula | C12H28INO4 |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | tetrapropylazanium periodate |
| SMILES | CCC[N+](CCC)(CCC)CCC.[O-][I+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C12H28N.IO4/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1(3,4)5/h5-12H2,1-4H3;/q+1;-1 |
| InChIKey | GEBWSNNQZDCSLF-UHFFFAOYSA-N |
| XLogP | -4.31 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | -4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrapropylazanium periodate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapropylazanium periodate?
The IUPAC name of tetrapropylazanium periodate (CID 3020483) is tetrapropylazanium periodate.
What is the SMILES notation for tetrapropylazanium periodate?
The canonical SMILES for tetrapropylazanium periodate is CCC[N+](CCC)(CCC)CCC.[O-][I+3]([O-])([O-])[O-].
What is the InChIKey of tetrapropylazanium periodate?
The InChIKey is GEBWSNNQZDCSLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N.IO4/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1(3,4)5/h5-12H2,1-4H3;/q+1;-1.
What are the key properties of tetrapropylazanium periodate?
tetrapropylazanium periodate has a molecular weight of 377.26 g/mol, XLogP of -4.31, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapropylazanium periodate is sourced from PubChem (CID 3020483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).