About dioxido(dioxo)molybdenum;bis(tetrapropylazanium)
dioxido(dioxo)molybdenum;bis(tetrapropylazanium) (PubChem CID 21245546) has the molecular formula C24H56MoN2O4
and a molecular weight of 532.66 g/mol. Its IUPAC name is dioxido(dioxo)molybdenum;bis(tetrapropylazanium).
Molecular Properties
| Compound Name | dioxido(dioxo)molybdenum;bis(tetrapropylazanium) |
| PubChem CID | 21245546 |
| Molecular Formula | C24H56MoN2O4 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | dioxido(dioxo)molybdenum;bis(tetrapropylazanium) |
| SMILES | CCC[N+](CCC)(CCC)CCC.CCC[N+](CCC)(CCC)CCC.O=[Mo](=O)([O-])[O-] |
| InChI | InChI=1S/2C12H28N.Mo.4O/c2*1-5-9-13(10-6-2,11-7-3)12-8-4;;;;;/h2*5-12H2,1-4H3;;;;;/q2*+1;;;;2*-1 |
| InChIKey | QDJCEAWNEZFTEB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dioxido(dioxo)molybdenum;bis(tetrapropylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(dioxo)molybdenum;bis(tetrapropylazanium)?
The IUPAC name of dioxido(dioxo)molybdenum;bis(tetrapropylazanium) (CID 21245546) is dioxido(dioxo)molybdenum;bis(tetrapropylazanium).
What is the SMILES notation for dioxido(dioxo)molybdenum;bis(tetrapropylazanium)?
The canonical SMILES for dioxido(dioxo)molybdenum;bis(tetrapropylazanium) is CCC[N+](CCC)(CCC)CCC.CCC[N+](CCC)(CCC)CCC.O=[Mo](=O)([O-])[O-].
What is the InChIKey of dioxido(dioxo)molybdenum;bis(tetrapropylazanium)?
The InChIKey is QDJCEAWNEZFTEB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H28N.Mo.4O/c2*1-5-9-13(10-6-2,11-7-3)12-8-4;;;;;/h2*5-12H2,1-4H3;;;;;/q2*+1;;;;2*-1.
What are the key properties of dioxido(dioxo)molybdenum;bis(tetrapropylazanium)?
dioxido(dioxo)molybdenum;bis(tetrapropylazanium) has a molecular weight of 532.66 g/mol, XLogP of 4.27, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(dioxo)molybdenum;bis(tetrapropylazanium) is sourced from PubChem (CID 21245546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).