About tetrapropylazanium;bromide;hydrobromide
tetrapropylazanium;bromide;hydrobromide (PubChem CID 87689277) has the molecular formula C12H29Br2N
and a molecular weight of 347.18 g/mol. Its IUPAC name is tetrapropylazanium;bromide;hydrobromide.
Molecular Properties
| Compound Name | tetrapropylazanium;bromide;hydrobromide |
| PubChem CID | 87689277 |
| Molecular Formula | C12H29Br2N |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | tetrapropylazanium;bromide;hydrobromide |
| SMILES | Br.CCC[N+](CCC)(CCC)CCC.[Br-] |
| InChI | InChI=1S/C12H28N.2BrH/c1-5-9-13(10-6-2,11-7-3)12-8-4;;/h5-12H2,1-4H3;2*1H/q+1;;/p-1 |
| InChIKey | HEGFXARXZIIEST-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrapropylazanium;bromide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapropylazanium;bromide;hydrobromide?
The IUPAC name of tetrapropylazanium;bromide;hydrobromide (CID 87689277) is tetrapropylazanium;bromide;hydrobromide.
What is the SMILES notation for tetrapropylazanium;bromide;hydrobromide?
The canonical SMILES for tetrapropylazanium;bromide;hydrobromide is Br.CCC[N+](CCC)(CCC)CCC.[Br-].
What is the InChIKey of tetrapropylazanium;bromide;hydrobromide?
The InChIKey is HEGFXARXZIIEST-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28N.2BrH/c1-5-9-13(10-6-2,11-7-3)12-8-4;;/h5-12H2,1-4H3;2*1H/q+1;;/p-1.
What are the key properties of tetrapropylazanium;bromide;hydrobromide?
tetrapropylazanium;bromide;hydrobromide has a molecular weight of 347.18 g/mol, XLogP of 1.03, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapropylazanium;bromide;hydrobromide is sourced from PubChem (CID 87689277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).