About boric acid;tetrapropylazanium;bromide
boric acid;tetrapropylazanium;bromide (PubChem CID 175148155) has the molecular formula C12H31BBrNO3
and a molecular weight of 328.10 g/mol. Its IUPAC name is boric acid;tetrapropylazanium;bromide.
Molecular Properties
| Compound Name | boric acid;tetrapropylazanium;bromide |
| PubChem CID | 175148155 |
| Molecular Formula | C12H31BBrNO3 |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | boric acid;tetrapropylazanium;bromide |
| SMILES | CCC[N+](CCC)(CCC)CCC.OB(O)O.[Br-] |
| InChI | InChI=1S/C12H28N.BH3O3.BrH/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1(3)4;/h5-12H2,1-4H3;2-4H;1H/q+1;;/p-1 |
| InChIKey | BHRCVWYFBKDBPC-UHFFFAOYSA-M |
| XLogP | -1.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze boric acid;tetrapropylazanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;tetrapropylazanium;bromide?
The IUPAC name of boric acid;tetrapropylazanium;bromide (CID 175148155) is boric acid;tetrapropylazanium;bromide.
What is the SMILES notation for boric acid;tetrapropylazanium;bromide?
The canonical SMILES for boric acid;tetrapropylazanium;bromide is CCC[N+](CCC)(CCC)CCC.OB(O)O.[Br-].
What is the InChIKey of boric acid;tetrapropylazanium;bromide?
The InChIKey is BHRCVWYFBKDBPC-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28N.BH3O3.BrH/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1(3)4;/h5-12H2,1-4H3;2-4H;1H/q+1;;/p-1.
What are the key properties of boric acid;tetrapropylazanium;bromide?
boric acid;tetrapropylazanium;bromide has a molecular weight of 328.10 g/mol, XLogP of -1.60, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;tetrapropylazanium;bromide is sourced from PubChem (CID 175148155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).