About tetrapropylazanium;trihydroxy(oxido)silane
tetrapropylazanium;trihydroxy(oxido)silane (PubChem CID 173094822) has the molecular formula C12H31NO4Si
and a molecular weight of 281.47 g/mol. Its IUPAC name is tetrapropylazanium;trihydroxy(oxido)silane.
Molecular Properties
| Compound Name | tetrapropylazanium;trihydroxy(oxido)silane |
| PubChem CID | 173094822 |
| Molecular Formula | C12H31NO4Si |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | tetrapropylazanium;trihydroxy(oxido)silane |
| SMILES | CCC[N+](CCC)(CCC)CCC.[O-][Si](O)(O)O |
| InChI | InChI=1S/C12H28N.H3O4Si/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-5(2,3)4/h5-12H2,1-4H3;1-3H/q+1;-1 |
| InChIKey | VAXIXTXEHKRYOC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 83.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrapropylazanium;trihydroxy(oxido)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapropylazanium;trihydroxy(oxido)silane?
The IUPAC name of tetrapropylazanium;trihydroxy(oxido)silane (CID 173094822) is tetrapropylazanium;trihydroxy(oxido)silane.
What is the SMILES notation for tetrapropylazanium;trihydroxy(oxido)silane?
The canonical SMILES for tetrapropylazanium;trihydroxy(oxido)silane is CCC[N+](CCC)(CCC)CCC.[O-][Si](O)(O)O.
What is the InChIKey of tetrapropylazanium;trihydroxy(oxido)silane?
The InChIKey is VAXIXTXEHKRYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N.H3O4Si/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-5(2,3)4/h5-12H2,1-4H3;1-3H/q+1;-1.
What are the key properties of tetrapropylazanium;trihydroxy(oxido)silane?
tetrapropylazanium;trihydroxy(oxido)silane has a molecular weight of 281.47 g/mol, XLogP of 0.20, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapropylazanium;trihydroxy(oxido)silane is sourced from PubChem (CID 173094822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).