About manganese;oxygen(2-);tetrapropylazanium
manganese;oxygen(2-);tetrapropylazanium (PubChem CID 159090995) has the molecular formula C12H28MnNO-
and a molecular weight of 257.30 g/mol. Its IUPAC name is manganese;oxygen(2-);tetrapropylazanium.
Molecular Properties
| Compound Name | manganese;oxygen(2-);tetrapropylazanium |
| PubChem CID | 159090995 |
| Molecular Formula | C12H28MnNO- |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | manganese;oxygen(2-);tetrapropylazanium |
| SMILES | CCC[N+](CCC)(CCC)CCC.[Mn].[O-2] |
| InChI | InChI=1S/C12H28N.Mn.O/c1-5-9-13(10-6-2,11-7-3)12-8-4;;/h5-12H2,1-4H3;;/q+1;;-2 |
| InChIKey | ZSIDLOULAZPDFX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 28.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze manganese;oxygen(2-);tetrapropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese;oxygen(2-);tetrapropylazanium?
The IUPAC name of manganese;oxygen(2-);tetrapropylazanium (CID 159090995) is manganese;oxygen(2-);tetrapropylazanium.
What is the SMILES notation for manganese;oxygen(2-);tetrapropylazanium?
The canonical SMILES for manganese;oxygen(2-);tetrapropylazanium is CCC[N+](CCC)(CCC)CCC.[Mn].[O-2].
What is the InChIKey of manganese;oxygen(2-);tetrapropylazanium?
The InChIKey is ZSIDLOULAZPDFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N.Mn.O/c1-5-9-13(10-6-2,11-7-3)12-8-4;;/h5-12H2,1-4H3;;/q+1;;-2.
What are the key properties of manganese;oxygen(2-);tetrapropylazanium?
manganese;oxygen(2-);tetrapropylazanium has a molecular weight of 257.30 g/mol, XLogP of 3.32, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for manganese;oxygen(2-);tetrapropylazanium is sourced from PubChem (CID 159090995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).