About boric acid;tetraheptylazanium
boric acid;tetraheptylazanium (PubChem CID 87469731) has the molecular formula C28H63BNO3+
and a molecular weight of 472.63 g/mol. Its IUPAC name is boric acid;tetraheptylazanium.
Molecular Properties
| Compound Name | boric acid;tetraheptylazanium |
| PubChem CID | 87469731 |
| Molecular Formula | C28H63BNO3+ |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.49 |
| IUPAC Name | boric acid;tetraheptylazanium |
| SMILES | CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.OB(O)O |
| InChI | InChI=1S/C28H60N.BH3O3/c1-5-9-13-17-21-25-29(26-22-18-14-10-6-2,27-23-19-15-11-7-3)28-24-20-16-12-8-4;2-1(3)4/h5-28H2,1-4H3;2-4H/q+1; |
| InChIKey | TYAFHJIIXYHNBX-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze boric acid;tetraheptylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;tetraheptylazanium?
The IUPAC name of boric acid;tetraheptylazanium (CID 87469731) is boric acid;tetraheptylazanium.
What is the SMILES notation for boric acid;tetraheptylazanium?
The canonical SMILES for boric acid;tetraheptylazanium is CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.OB(O)O.
What is the InChIKey of boric acid;tetraheptylazanium?
The InChIKey is TYAFHJIIXYHNBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H60N.BH3O3/c1-5-9-13-17-21-25-29(26-22-18-14-10-6-2,27-23-19-15-11-7-3)28-24-20-16-12-8-4;2-1(3)4/h5-28H2,1-4H3;2-4H/q+1;.
What are the key properties of boric acid;tetraheptylazanium?
boric acid;tetraheptylazanium has a molecular weight of 472.63 g/mol, XLogP of 7.63, 24 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;tetraheptylazanium is sourced from PubChem (CID 87469731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).