About heptyl(tripentyl)azanium
heptyl(tripentyl)azanium (PubChem CID 87447622) has the molecular formula C22H48N+
and a molecular weight of 326.63 g/mol. Its IUPAC name is heptyl(tripentyl)azanium.
Molecular Properties
| Compound Name | heptyl(tripentyl)azanium |
| PubChem CID | 87447622 |
| Molecular Formula | C22H48N+ |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.38 |
| IUPAC Name | heptyl(tripentyl)azanium |
| SMILES | CCCCCCC[N+](CCCCC)(CCCCC)CCCCC |
| InChI | InChI=1S/C22H48N/c1-5-9-13-14-18-22-23(19-15-10-6-2,20-16-11-7-3)21-17-12-8-4/h5-22H2,1-4H3/q+1 |
| InChIKey | VTQINSVRDATHQY-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze heptyl(tripentyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl(tripentyl)azanium?
The IUPAC name of heptyl(tripentyl)azanium (CID 87447622) is heptyl(tripentyl)azanium.
What is the SMILES notation for heptyl(tripentyl)azanium?
The canonical SMILES for heptyl(tripentyl)azanium is CCCCCCC[N+](CCCCC)(CCCCC)CCCCC.
What is the InChIKey of heptyl(tripentyl)azanium?
The InChIKey is VTQINSVRDATHQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48N/c1-5-9-13-14-18-22-23(19-15-10-6-2,20-16-11-7-3)21-17-12-8-4/h5-22H2,1-4H3/q+1.
What are the key properties of heptyl(tripentyl)azanium?
heptyl(tripentyl)azanium has a molecular weight of 326.63 g/mol, XLogP of 7.34, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl(tripentyl)azanium is sourced from PubChem (CID 87447622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).