About trihexyl(nonyl)azanium
trihexyl(nonyl)azanium (PubChem CID 87777679) has the molecular formula C27H58N+
and a molecular weight of 396.77 g/mol. Its IUPAC name is trihexyl(nonyl)azanium.
Molecular Properties
| Compound Name | trihexyl(nonyl)azanium |
| PubChem CID | 87777679 |
| Molecular Formula | C27H58N+ |
| Molecular Weight | 396.77 g/mol |
| Exact Mass | 396.46 |
| IUPAC Name | trihexyl(nonyl)azanium |
| SMILES | CCCCCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C27H58N/c1-5-9-13-17-18-19-23-27-28(24-20-14-10-6-2,25-21-15-11-7-3)26-22-16-12-8-4/h5-27H2,1-4H3/q+1 |
| InChIKey | IVGGHPCZXSCTRW-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.77 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trihexyl(nonyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trihexyl(nonyl)azanium?
The IUPAC name of trihexyl(nonyl)azanium (CID 87777679) is trihexyl(nonyl)azanium.
What is the SMILES notation for trihexyl(nonyl)azanium?
The canonical SMILES for trihexyl(nonyl)azanium is CCCCCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC.
What is the InChIKey of trihexyl(nonyl)azanium?
The InChIKey is IVGGHPCZXSCTRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H58N/c1-5-9-13-17-18-19-23-27-28(24-20-14-10-6-2,25-21-15-11-7-3)26-22-16-12-8-4/h5-27H2,1-4H3/q+1.
What are the key properties of trihexyl(nonyl)azanium?
trihexyl(nonyl)azanium has a molecular weight of 396.77 g/mol, XLogP of 9.29, 23 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trihexyl(nonyl)azanium is sourced from PubChem (CID 87777679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).