About dioxido(oxo)silane;bis(tetrapropylazanium)
dioxido(oxo)silane;bis(tetrapropylazanium) (PubChem CID 87503534) has the molecular formula C24H56N2O3Si
and a molecular weight of 448.81 g/mol. Its IUPAC name is dioxido(oxo)silane;bis(tetrapropylazanium).
Molecular Properties
| Compound Name | dioxido(oxo)silane;bis(tetrapropylazanium) |
| PubChem CID | 87503534 |
| Molecular Formula | C24H56N2O3Si |
| Molecular Weight | 448.81 g/mol |
| Exact Mass | 448.41 |
| IUPAC Name | dioxido(oxo)silane;bis(tetrapropylazanium) |
| SMILES | CCC[N+](CCC)(CCC)CCC.CCC[N+](CCC)(CCC)CCC.O=[Si]([O-])[O-] |
| InChI | InChI=1S/2C12H28N.O3Si/c2*1-5-9-13(10-6-2,11-7-3)12-8-4;1-4(2)3/h2*5-12H2,1-4H3;/q2*+1;-2 |
| InChIKey | KXRRAJVTIDDFDY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)silane;bis(tetrapropylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)silane;bis(tetrapropylazanium)?
The IUPAC name of dioxido(oxo)silane;bis(tetrapropylazanium) (CID 87503534) is dioxido(oxo)silane;bis(tetrapropylazanium).
What is the SMILES notation for dioxido(oxo)silane;bis(tetrapropylazanium)?
The canonical SMILES for dioxido(oxo)silane;bis(tetrapropylazanium) is CCC[N+](CCC)(CCC)CCC.CCC[N+](CCC)(CCC)CCC.O=[Si]([O-])[O-].
What is the InChIKey of dioxido(oxo)silane;bis(tetrapropylazanium)?
The InChIKey is KXRRAJVTIDDFDY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H28N.O3Si/c2*1-5-9-13(10-6-2,11-7-3)12-8-4;1-4(2)3/h2*5-12H2,1-4H3;/q2*+1;-2.
What are the key properties of dioxido(oxo)silane;bis(tetrapropylazanium)?
dioxido(oxo)silane;bis(tetrapropylazanium) has a molecular weight of 448.81 g/mol, XLogP of 4.01, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)silane;bis(tetrapropylazanium) is sourced from PubChem (CID 87503534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).