About 4-methoxy-4-oxobutanoate
4-methoxy-4-oxobutanoate (PubChem CID 6930703) has the molecular formula C5H7O4-
and a molecular weight of 131.11 g/mol. Its IUPAC name is 4-methoxy-4-oxobutanoate.
Molecular Properties
| Compound Name | 4-methoxy-4-oxobutanoate |
| PubChem CID | 6930703 |
| Molecular Formula | C5H7O4- |
| Molecular Weight | 131.11 g/mol |
| Exact Mass | 131.03 |
| IUPAC Name | 4-methoxy-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)[O-] |
| InChI | InChI=1S/C5H8O4/c1-9-5(8)3-2-4(6)7/h2-3H2,1H3,(H,6,7)/p-1 |
| InChIKey | JDRMYOQETPMYQX-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.11 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-4-oxobutanoate?
The IUPAC name of 4-methoxy-4-oxobutanoate (CID 6930703) is 4-methoxy-4-oxobutanoate.
What is the SMILES notation for 4-methoxy-4-oxobutanoate?
The canonical SMILES for 4-methoxy-4-oxobutanoate is COC(=O)CCC(=O)[O-].
What is the InChIKey of 4-methoxy-4-oxobutanoate?
The InChIKey is JDRMYOQETPMYQX-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O4/c1-9-5(8)3-2-4(6)7/h2-3H2,1H3,(H,6,7)/p-1.
What are the key properties of 4-methoxy-4-oxobutanoate?
4-methoxy-4-oxobutanoate has a molecular weight of 131.11 g/mol, XLogP of -1.31, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-4-oxobutanoate is sourced from PubChem (CID 6930703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).