C19H33NO6 — CID 118645211
1-butylpyridin-1-ium;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate (PubChem CID 118645211) has the molecular formula C19H33NO6 and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-butylpyridin-1-ium;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate.
| Compound Name | 1-butylpyridin-1-ium;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 118645211 |
| Molecular Formula | C19H33NO6 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 1-butylpyridin-1-ium;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate |
| SMILES | CCCC[n+]1ccccc1.COCCOCCOCCOCCC(=O)[O-] |
| InChI | InChI=1S/C10H20O6.C9H14N/c1-13-4-5-15-8-9-16-7-6-14-3-2-10(11)12;1-2-3-7-10-8-5-4-6-9-10/h2-9H2,1H3,(H,11,12);4-6,8-9H,2-3,7H2,1H3/q;+1/p-1 |
| InChIKey | FQGRWQSRTLBFFI-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|