About 1-butylpyridin-1-ium;chloroaluminum(2+)
1-butylpyridin-1-ium;chloroaluminum(2+) (PubChem CID 68542830) has the molecular formula C9H14AlClN+3
and a molecular weight of 198.65 g/mol. Its IUPAC name is 1-butylpyridin-1-ium;chloroaluminum(2+).
Molecular Properties
| Compound Name | 1-butylpyridin-1-ium;chloroaluminum(2+) |
| PubChem CID | 68542830 |
| Molecular Formula | C9H14AlClN+3 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 1-butylpyridin-1-ium;chloroaluminum(2+) |
| SMILES | CCCC[n+]1ccccc1.[Al+2]Cl |
| InChI | InChI=1S/C9H14N.Al.ClH/c1-2-3-7-10-8-5-4-6-9-10;;/h4-6,8-9H,2-3,7H2,1H3;;1H/q+1;+3;/p-1 |
| InChIKey | ACADBFGKPXTDHQ-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butylpyridin-1-ium;chloroaluminum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylpyridin-1-ium;chloroaluminum(2+)?
The IUPAC name of 1-butylpyridin-1-ium;chloroaluminum(2+) (CID 68542830) is 1-butylpyridin-1-ium;chloroaluminum(2+).
What is the SMILES notation for 1-butylpyridin-1-ium;chloroaluminum(2+)?
The canonical SMILES for 1-butylpyridin-1-ium;chloroaluminum(2+) is CCCC[n+]1ccccc1.[Al+2]Cl.
What is the InChIKey of 1-butylpyridin-1-ium;chloroaluminum(2+)?
The InChIKey is ACADBFGKPXTDHQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H14N.Al.ClH/c1-2-3-7-10-8-5-4-6-9-10;;/h4-6,8-9H,2-3,7H2,1H3;;1H/q+1;+3;/p-1.
What are the key properties of 1-butylpyridin-1-ium;chloroaluminum(2+)?
1-butylpyridin-1-ium;chloroaluminum(2+) has a molecular weight of 198.65 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylpyridin-1-ium;chloroaluminum(2+) is sourced from PubChem (CID 68542830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).