About 1-butylpyridin-1-ium;tetrachloroiron(1-)
1-butylpyridin-1-ium;tetrachloroiron(1-) (PubChem CID 11573533) has the molecular formula C9H14Cl4FeN
and a molecular weight of 333.88 g/mol. Its IUPAC name is 1-butylpyridin-1-ium;tetrachloroiron(1-).
Molecular Properties
| Compound Name | 1-butylpyridin-1-ium;tetrachloroiron(1-) |
| PubChem CID | 11573533 |
| Molecular Formula | C9H14Cl4FeN |
| Molecular Weight | 333.88 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | 1-butylpyridin-1-ium;tetrachloroiron(1-) |
| SMILES | CCCC[n+]1ccccc1.Cl[Fe-](Cl)(Cl)Cl |
| InChI | InChI=1S/C9H14N.4ClH.Fe/c1-2-3-7-10-8-5-4-6-9-10;;;;;/h4-6,8-9H,2-3,7H2,1H3;4*1H;/q+1;;;;;+3/p-4 |
| InChIKey | RKZMIXDVXMKZFO-UHFFFAOYSA-J |
| XLogP | 4.53 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butylpyridin-1-ium;tetrachloroiron(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylpyridin-1-ium;tetrachloroiron(1-)?
The IUPAC name of 1-butylpyridin-1-ium;tetrachloroiron(1-) (CID 11573533) is 1-butylpyridin-1-ium;tetrachloroiron(1-).
What is the SMILES notation for 1-butylpyridin-1-ium;tetrachloroiron(1-)?
The canonical SMILES for 1-butylpyridin-1-ium;tetrachloroiron(1-) is CCCC[n+]1ccccc1.Cl[Fe-](Cl)(Cl)Cl.
What is the InChIKey of 1-butylpyridin-1-ium;tetrachloroiron(1-)?
The InChIKey is RKZMIXDVXMKZFO-UHFFFAOYSA-J. The full InChI is InChI=1S/C9H14N.4ClH.Fe/c1-2-3-7-10-8-5-4-6-9-10;;;;;/h4-6,8-9H,2-3,7H2,1H3;4*1H;/q+1;;;;;+3/p-4.
What are the key properties of 1-butylpyridin-1-ium;tetrachloroiron(1-)?
1-butylpyridin-1-ium;tetrachloroiron(1-) has a molecular weight of 333.88 g/mol, XLogP of 4.53, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylpyridin-1-ium;tetrachloroiron(1-) is sourced from PubChem (CID 11573533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).