C14H23NO2 — CID 122507043
butanoate;1-butyl-3-methylpyridin-1-ium (PubChem CID 122507043) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is butanoate;1-butyl-3-methylpyridin-1-ium.
| Compound Name | butanoate;1-butyl-3-methylpyridin-1-ium |
|---|---|
| PubChem CID | 122507043 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | butanoate;1-butyl-3-methylpyridin-1-ium |
| SMILES | CCCC(=O)[O-].CCCC[n+]1cccc(C)c1 |
| InChI | InChI=1S/C10H16N.C4H8O2/c1-3-4-7-11-8-5-6-10(2)9-11;1-2-3-4(5)6/h5-6,8-9H,3-4,7H2,1-2H3;2-3H2,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | AAKPXTLRYGNRKI-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|