C20H32FN2O3P — CID 141205317
bis(1-butyl-3-methylpyridin-1-ium);fluoro-dioxido-oxo-λ5-phosphane (PubChem CID 141205317) has the molecular formula C20H32FN2O3P and a molecular weight of 398.46 g/mol. Its IUPAC name is bis(1-butyl-3-methylpyridin-1-ium);fluoro-dioxido-oxo-λ5-phosphane.
| Compound Name | bis(1-butyl-3-methylpyridin-1-ium);fluoro-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 141205317 |
| Molecular Formula | C20H32FN2O3P |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | bis(1-butyl-3-methylpyridin-1-ium);fluoro-dioxido-oxo-λ5-phosphane |
| SMILES | CCCC[n+]1cccc(C)c1.CCCC[n+]1cccc(C)c1.O=P([O-])([O-])F |
| InChI | InChI=1S/2C10H16N.FH2O3P/c2*1-3-4-7-11-8-5-6-10(2)9-11;1-5(2,3)4/h2*5-6,8-9H,3-4,7H2,1-2H3;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | SJQAOWBZHIVNPO-UHFFFAOYSA-L |
| XLogP | 2.95 |
| TPSA | 70.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|