C14H16F2N5P — CID 86295599
CID 86295599 (PubChem CID 86295599) has the molecular formula C14H16F2N5P and a molecular weight of 323.29 g/mol.
| Compound Name | CID 86295599 |
|---|---|
| PubChem CID | 86295599 |
| Molecular Formula | C14H16F2N5P |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | — |
| SMILES | CCCC[n+]1cccc(C)c1.N#C[P-](F)(F)(C#N)(C#N)C#N |
| InChI | InChI=1S/C10H16N.C4F2N4P/c1-3-4-7-11-8-5-6-10(2)9-11;5-11(6,1-7,2-8,3-9)4-10/h5-6,8-9H,3-4,7H2,1-2H3;/q+1;-1 |
| InChIKey | UDTYOYSNGOLWDS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 99.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|