About 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide
1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide (PubChem CID 25241724) has the molecular formula C10H16Br3N
and a molecular weight of 389.96 g/mol. Its IUPAC name is 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide.
Molecular Properties
| Compound Name | 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide |
| PubChem CID | 25241724 |
| Molecular Formula | C10H16Br3N |
| Molecular Weight | 389.96 g/mol |
| Exact Mass | 386.88 |
| IUPAC Name | 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide |
| SMILES | BrBr.CCCC[n+]1cccc(C)c1.[Br-] |
| InChI | InChI=1S/C10H16N.Br2.BrH/c1-3-4-7-11-8-5-6-10(2)9-11;1-2;/h5-6,8-9H,3-4,7H2,1-2H3;;1H/q+1;;/p-1 |
| InChIKey | TXOAACQQDCSLEZ-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.96 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide?
The IUPAC name of 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide (CID 25241724) is 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide.
What is the SMILES notation for 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide?
The canonical SMILES for 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide is BrBr.CCCC[n+]1cccc(C)c1.[Br-].
What is the InChIKey of 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide?
The InChIKey is TXOAACQQDCSLEZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H16N.Br2.BrH/c1-3-4-7-11-8-5-6-10(2)9-11;1-2;/h5-6,8-9H,3-4,7H2,1-2H3;;1H/q+1;;/p-1.
What are the key properties of 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide?
1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide has a molecular weight of 389.96 g/mol, XLogP of 0.78, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylpyridin-1-ium;molecular bromine;bromide is sourced from PubChem (CID 25241724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).