About 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide
1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide (PubChem CID 172850562) has the molecular formula C20H32I2N2
and a molecular weight of 554.30 g/mol. Its IUPAC name is 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide.
Molecular Properties
| Compound Name | 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide |
| PubChem CID | 172850562 |
| Molecular Formula | C20H32I2N2 |
| Molecular Weight | 554.30 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide |
| SMILES | CCCC[n+]1ccc(C)cc1.CCCC[n+]1cccc(C)c1.[I-].[I-] |
| InChI | InChI=1S/2C10H16N.2HI/c1-3-4-7-11-8-5-10(2)6-9-11;1-3-4-7-11-8-5-6-10(2)9-11;;/h2*5-6,8-9H,3-4,7H2,1-2H3;2*1H/q2*+1;;/p-2 |
| InChIKey | XZWWJVWQNSHFRJ-UHFFFAOYSA-L |
| XLogP | -1.83 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 554.30 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide?
The IUPAC name of 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide (CID 172850562) is 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide.
What is the SMILES notation for 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide?
The canonical SMILES for 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide is CCCC[n+]1ccc(C)cc1.CCCC[n+]1cccc(C)c1.[I-].[I-].
What is the InChIKey of 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide?
The InChIKey is XZWWJVWQNSHFRJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H16N.2HI/c1-3-4-7-11-8-5-10(2)6-9-11;1-3-4-7-11-8-5-6-10(2)9-11;;/h2*5-6,8-9H,3-4,7H2,1-2H3;2*1H/q2*+1;;/p-2.
What are the key properties of 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide?
1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide has a molecular weight of 554.30 g/mol, XLogP of -1.83, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylpyridin-1-ium;1-butyl-4-methylpyridin-1-ium;diiodide is sourced from PubChem (CID 172850562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).