C14H16F10N2O4S2 — CID 141236058
bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;1-butyl-3-methylpyridin-1-ium (PubChem CID 141236058) has the molecular formula C14H16F10N2O4S2 and a molecular weight of 530.41 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;1-butyl-3-methylpyridin-1-ium.
| Compound Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;1-butyl-3-methylpyridin-1-ium |
|---|---|
| PubChem CID | 141236058 |
| Molecular Formula | C14H16F10N2O4S2 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;1-butyl-3-methylpyridin-1-ium |
| SMILES | CCCC[n+]1cccc(C)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H16N.C4F10NO4S2/c1-3-4-7-11-8-5-6-10(2)9-11;5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10/h5-6,8-9H,3-4,7H2,1-2H3;/q+1;-1 |
| InChIKey | OEPKLWHTHCQEOQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 86.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|