C13H17F6N2O3S+ — CID 87208294
1-butyl-3-methylpyridin-1-ium;2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide (PubChem CID 87208294) has the molecular formula C13H17F6N2O3S+ and a molecular weight of 395.35 g/mol. Its IUPAC name is 1-butyl-3-methylpyridin-1-ium;2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide.
| Compound Name | 1-butyl-3-methylpyridin-1-ium;2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 87208294 |
| Molecular Formula | C13H17F6N2O3S+ |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 1-butyl-3-methylpyridin-1-ium;2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide |
| SMILES | CCCC[n+]1cccc(C)c1.O=C(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H16N.C3HF6NO3S/c1-3-4-7-11-8-5-6-10(2)9-11;4-2(5,6)1(11)10-14(12,13)3(7,8)9/h5-6,8-9H,3-4,7H2,1-2H3;(H,10,11)/q+1; |
| InChIKey | VWRPMASNDUMPEH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|