C22H30F6N2O4S2+2 — CID 158754733
1-butyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)pyridin-1-ium;1-butyl-3-methylpyridin-1-ium (PubChem CID 158754733) has the molecular formula C22H30F6N2O4S2+2 and a molecular weight of 564.61 g/mol. Its IUPAC name is 1-butyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)pyridin-1-ium;1-butyl-3-methylpyridin-1-ium.
| Compound Name | 1-butyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)pyridin-1-ium;1-butyl-3-methylpyridin-1-ium |
|---|---|
| PubChem CID | 158754733 |
| Molecular Formula | C22H30F6N2O4S2+2 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 1-butyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)pyridin-1-ium;1-butyl-3-methylpyridin-1-ium |
| SMILES | CCCC[n+]1ccc(S(=O)(=O)C(F)(F)F)c(C)c1S(=O)(=O)C(F)(F)F.CCCC[n+]1cccc(C)c1 |
| InChI | InChI=1S/C12H14F6NO4S2.C10H16N/c1-3-4-6-19-7-5-9(24(20,21)11(13,14)15)8(2)10(19)25(22,23)12(16,17)18;1-3-4-7-11-8-5-6-10(2)9-11/h5,7H,3-4,6H2,1-2H3;5-6,8-9H,3-4,7H2,1-2H3/q2*+1 |
| InChIKey | INXQCHYZYHECED-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|