About dibutylbismuthanylium;3-methylsulfanylpropanoate
dibutylbismuthanylium;3-methylsulfanylpropanoate (PubChem CID 88759401) has the molecular formula C12H25BiO2S
and a molecular weight of 442.38 g/mol. Its IUPAC name is dibutylbismuthanylium;3-methylsulfanylpropanoate.
Molecular Properties
| Compound Name | dibutylbismuthanylium;3-methylsulfanylpropanoate |
| PubChem CID | 88759401 |
| Molecular Formula | C12H25BiO2S |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | dibutylbismuthanylium;3-methylsulfanylpropanoate |
| SMILES | CCCC[Bi+]CCCC.CSCCC(=O)[O-] |
| InChI | InChI=1S/C4H8O2S.2C4H9.Bi/c1-7-3-2-4(5)6;2*1-3-4-2;/h2-3H2,1H3,(H,5,6);2*1,3-4H2,2H3;/q;;;+1/p-1 |
| InChIKey | GEZPHBWSWHNYCQ-UHFFFAOYSA-M |
| XLogP | 2.62 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dibutylbismuthanylium;3-methylsulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutylbismuthanylium;3-methylsulfanylpropanoate?
The IUPAC name of dibutylbismuthanylium;3-methylsulfanylpropanoate (CID 88759401) is dibutylbismuthanylium;3-methylsulfanylpropanoate.
What is the SMILES notation for dibutylbismuthanylium;3-methylsulfanylpropanoate?
The canonical SMILES for dibutylbismuthanylium;3-methylsulfanylpropanoate is CCCC[Bi+]CCCC.CSCCC(=O)[O-].
What is the InChIKey of dibutylbismuthanylium;3-methylsulfanylpropanoate?
The InChIKey is GEZPHBWSWHNYCQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8O2S.2C4H9.Bi/c1-7-3-2-4(5)6;2*1-3-4-2;/h2-3H2,1H3,(H,5,6);2*1,3-4H2,2H3;/q;;;+1/p-1.
What are the key properties of dibutylbismuthanylium;3-methylsulfanylpropanoate?
dibutylbismuthanylium;3-methylsulfanylpropanoate has a molecular weight of 442.38 g/mol, XLogP of 2.62, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibutylbismuthanylium;3-methylsulfanylpropanoate is sourced from PubChem (CID 88759401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).