About 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium
2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium (PubChem CID 118645014) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium.
Molecular Properties
| Compound Name | 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium |
| PubChem CID | 118645014 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium |
| SMILES | C=CC[N+]1(C)CCCC1.COCC(=O)[O-] |
| InChI | InChI=1S/C8H16N.C3H6O3/c1-3-6-9(2)7-4-5-8-9;1-6-2-3(4)5/h3H,1,4-8H2,2H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | ZIKTTYUSRIINTI-UHFFFAOYSA-M |
| XLogP | -0.20 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium?
The IUPAC name of 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium (CID 118645014) is 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium.
What is the SMILES notation for 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium?
The canonical SMILES for 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium is C=CC[N+]1(C)CCCC1.COCC(=O)[O-].
What is the InChIKey of 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium?
The InChIKey is ZIKTTYUSRIINTI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16N.C3H6O3/c1-3-6-9(2)7-4-5-8-9;1-6-2-3(4)5/h3H,1,4-8H2,2H3;2H2,1H3,(H,4,5)/q+1;/p-1.
What are the key properties of 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium?
2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium has a molecular weight of 215.29 g/mol, XLogP of -0.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyacetate;1-methyl-1-prop-2-enylpyrrolidin-1-ium is sourced from PubChem (CID 118645014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).