About lithium 2-ethenoxyacetate
lithium 2-ethenoxyacetate (PubChem CID 172773108) has the molecular formula C4H5LiO3
and a molecular weight of 108.02 g/mol. Its IUPAC name is lithium 2-ethenoxyacetate.
Molecular Properties
| Compound Name | lithium 2-ethenoxyacetate |
| PubChem CID | 172773108 |
| Molecular Formula | C4H5LiO3 |
| Molecular Weight | 108.02 g/mol |
| Exact Mass | 108.04 |
| IUPAC Name | lithium 2-ethenoxyacetate |
| SMILES | C=COCC(=O)[O-].[Li+] |
| InChI | InChI=1S/C4H6O3.Li/c1-2-7-3-4(5)6;/h2H,1,3H2,(H,5,6);/q;+1/p-1 |
| InChIKey | NFMKNMFUUBKGRQ-UHFFFAOYSA-M |
| XLogP | -4.10 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.02 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-ethenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-ethenoxyacetate?
The IUPAC name of lithium 2-ethenoxyacetate (CID 172773108) is lithium 2-ethenoxyacetate.
What is the SMILES notation for lithium 2-ethenoxyacetate?
The canonical SMILES for lithium 2-ethenoxyacetate is C=COCC(=O)[O-].[Li+].
What is the InChIKey of lithium 2-ethenoxyacetate?
The InChIKey is NFMKNMFUUBKGRQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O3.Li/c1-2-7-3-4(5)6;/h2H,1,3H2,(H,5,6);/q;+1/p-1.
What are the key properties of lithium 2-ethenoxyacetate?
lithium 2-ethenoxyacetate has a molecular weight of 108.02 g/mol, XLogP of -4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-ethenoxyacetate is sourced from PubChem (CID 172773108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).