About 4-ethenoxybutanoate
4-ethenoxybutanoate (PubChem CID 23167560) has the molecular formula C6H9O3-
and a molecular weight of 129.13 g/mol. Its IUPAC name is 4-ethenoxybutanoate.
Molecular Properties
| Compound Name | 4-ethenoxybutanoate |
| PubChem CID | 23167560 |
| Molecular Formula | C6H9O3- |
| Molecular Weight | 129.13 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 4-ethenoxybutanoate |
| SMILES | C=COCCCC(=O)[O-] |
| InChI | InChI=1S/C6H10O3/c1-2-9-5-3-4-6(7)8/h2H,1,3-5H2,(H,7,8)/p-1 |
| InChIKey | QGGMKWXOKZTWCQ-UHFFFAOYSA-M |
| XLogP | -0.32 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.13 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenoxybutanoate?
The IUPAC name of 4-ethenoxybutanoate (CID 23167560) is 4-ethenoxybutanoate.
What is the SMILES notation for 4-ethenoxybutanoate?
The canonical SMILES for 4-ethenoxybutanoate is C=COCCCC(=O)[O-].
What is the InChIKey of 4-ethenoxybutanoate?
The InChIKey is QGGMKWXOKZTWCQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H10O3/c1-2-9-5-3-4-6(7)8/h2H,1,3-5H2,(H,7,8)/p-1.
What are the key properties of 4-ethenoxybutanoate?
4-ethenoxybutanoate has a molecular weight of 129.13 g/mol, XLogP of -0.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenoxybutanoate is sourced from PubChem (CID 23167560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).