C10H19NO2 — CID 138746197
6-ethenoxy-N,N-dimethylhexanamide (PubChem CID 138746197) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 6-ethenoxy-N,N-dimethylhexanamide.
| Compound Name | 6-ethenoxy-N,N-dimethylhexanamide |
|---|---|
| PubChem CID | 138746197 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 6-ethenoxy-N,N-dimethylhexanamide |
| SMILES | C=COCCCCCC(=O)N(C)C |
| InChI | InChI=1S/C10H19NO2/c1-4-13-9-7-5-6-8-10(12)11(2)3/h4H,1,5-9H2,2-3H3 |
| InChIKey | ZDRNCTJIBGFXQY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|