C13H27NO2 — CID 14819907
11-hydroxy-N,N-dimethylundecanamide (PubChem CID 14819907) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 11-hydroxy-N,N-dimethylundecanamide.
| Compound Name | 11-hydroxy-N,N-dimethylundecanamide |
|---|---|
| PubChem CID | 14819907 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 11-hydroxy-N,N-dimethylundecanamide |
| SMILES | CN(C)C(=O)CCCCCCCCCCO |
| InChI | InChI=1S/C13H27NO2/c1-14(2)13(16)11-9-7-5-3-4-6-8-10-12-15/h15H,3-12H2,1-2H3 |
| InChIKey | ZSQFFVQWLDRJNM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|