About 2-prop-2-enoxyacetate
2-prop-2-enoxyacetate (PubChem CID 19028340) has the molecular formula C5H7O3-
and a molecular weight of 115.11 g/mol. Its IUPAC name is 2-prop-2-enoxyacetate.
Molecular Properties
| Compound Name | 2-prop-2-enoxyacetate |
| PubChem CID | 19028340 |
| Molecular Formula | C5H7O3- |
| Molecular Weight | 115.11 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 2-prop-2-enoxyacetate |
| SMILES | C=CCOCC(=O)[O-] |
| InChI | InChI=1S/C5H8O3/c1-2-3-8-4-5(6)7/h2H,1,3-4H2,(H,6,7)/p-1 |
| InChIKey | QXWUJRONCAPLLL-UHFFFAOYSA-M |
| XLogP | -1.06 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.11 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoxyacetate?
The IUPAC name of 2-prop-2-enoxyacetate (CID 19028340) is 2-prop-2-enoxyacetate.
What is the SMILES notation for 2-prop-2-enoxyacetate?
The canonical SMILES for 2-prop-2-enoxyacetate is C=CCOCC(=O)[O-].
What is the InChIKey of 2-prop-2-enoxyacetate?
The InChIKey is QXWUJRONCAPLLL-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O3/c1-2-3-8-4-5(6)7/h2H,1,3-4H2,(H,6,7)/p-1.
What are the key properties of 2-prop-2-enoxyacetate?
2-prop-2-enoxyacetate has a molecular weight of 115.11 g/mol, XLogP of -1.06, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoxyacetate is sourced from PubChem (CID 19028340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).