About carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+)
carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+) (PubChem CID 10448493) has the molecular formula C7H4O8Ru
and a molecular weight of 317.17 g/mol. Its IUPAC name is carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+).
Molecular Properties
| Compound Name | carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+) |
| PubChem CID | 10448493 |
| Molecular Formula | C7H4O8Ru |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.89 |
| IUPAC Name | carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+) |
| SMILES | O=C([O-])COCC(=O)[O-].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Ru+2] |
| InChI | InChI=1S/C4H6O5.3CO.Ru/c5-3(6)1-9-2-4(7)8;3*1-2;/h1-2H2,(H,5,6)(H,7,8);;;;/q;;;;+2/p-2 |
| InChIKey | LQFMVVGYWJIVKG-UHFFFAOYSA-L |
| XLogP | -3.61 |
| TPSA | 149.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+)?
The IUPAC name of carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+) (CID 10448493) is carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+).
What is the SMILES notation for carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+)?
The canonical SMILES for carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+) is O=C([O-])COCC(=O)[O-].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Ru+2].
What is the InChIKey of carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+)?
The InChIKey is LQFMVVGYWJIVKG-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O5.3CO.Ru/c5-3(6)1-9-2-4(7)8;3*1-2;/h1-2H2,(H,5,6)(H,7,8);;;;/q;;;;+2/p-2.
What are the key properties of carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+)?
carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+) has a molecular weight of 317.17 g/mol, XLogP of -3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;2-(carboxylatomethoxy)acetate;ruthenium(2+) is sourced from PubChem (CID 10448493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).