About dioxouranium(2+);bis(2-ethoxyacetate)
dioxouranium(2+);bis(2-ethoxyacetate) (PubChem CID 19374008) has the molecular formula C8H14O8U
and a molecular weight of 476.22 g/mol. Its IUPAC name is dioxouranium(2+);bis(2-ethoxyacetate).
Molecular Properties
| Compound Name | dioxouranium(2+);bis(2-ethoxyacetate) |
| PubChem CID | 19374008 |
| Molecular Formula | C8H14O8U |
| Molecular Weight | 476.22 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | dioxouranium(2+);bis(2-ethoxyacetate) |
| SMILES | CCOCC(=O)[O-].CCOCC(=O)[O-].O=[U+2]=O |
| InChI | InChI=1S/2C4H8O3.2O.U/c2*1-2-7-3-4(5)6;;;/h2*2-3H2,1H3,(H,5,6);;;/q;;;;+2/p-2 |
| InChIKey | KNMWAKBDOGJFRR-UHFFFAOYSA-L |
| XLogP | -2.69 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.22 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dioxouranium(2+);bis(2-ethoxyacetate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxouranium(2+);bis(2-ethoxyacetate)?
The IUPAC name of dioxouranium(2+);bis(2-ethoxyacetate) (CID 19374008) is dioxouranium(2+);bis(2-ethoxyacetate).
What is the SMILES notation for dioxouranium(2+);bis(2-ethoxyacetate)?
The canonical SMILES for dioxouranium(2+);bis(2-ethoxyacetate) is CCOCC(=O)[O-].CCOCC(=O)[O-].O=[U+2]=O.
What is the InChIKey of dioxouranium(2+);bis(2-ethoxyacetate)?
The InChIKey is KNMWAKBDOGJFRR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H8O3.2O.U/c2*1-2-7-3-4(5)6;;;/h2*2-3H2,1H3,(H,5,6);;;/q;;;;+2/p-2.
What are the key properties of dioxouranium(2+);bis(2-ethoxyacetate)?
dioxouranium(2+);bis(2-ethoxyacetate) has a molecular weight of 476.22 g/mol, XLogP of -2.69, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dioxouranium(2+);bis(2-ethoxyacetate) is sourced from PubChem (CID 19374008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).