About 2-methanidyloxyacetate;methanolate
2-methanidyloxyacetate;methanolate (PubChem CID 90717089) has the molecular formula C4H7O4-3
and a molecular weight of 119.10 g/mol. Its IUPAC name is 2-methanidyloxyacetate;methanolate.
Molecular Properties
| Compound Name | 2-methanidyloxyacetate;methanolate |
| PubChem CID | 90717089 |
| Molecular Formula | C4H7O4-3 |
| Molecular Weight | 119.10 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | 2-methanidyloxyacetate;methanolate |
| SMILES | C[O-].[CH2-]OCC(=O)[O-] |
| InChI | InChI=1S/C3H5O3.CH3O/c1-6-2-3(4)5;1-2/h1-2H2,(H,4,5);1H3/q2*-1/p-1 |
| InChIKey | DOJMDSGJPHEMBV-UHFFFAOYSA-M |
| XLogP | -2.48 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.10 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidyloxyacetate;methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidyloxyacetate;methanolate?
The IUPAC name of 2-methanidyloxyacetate;methanolate (CID 90717089) is 2-methanidyloxyacetate;methanolate.
What is the SMILES notation for 2-methanidyloxyacetate;methanolate?
The canonical SMILES for 2-methanidyloxyacetate;methanolate is C[O-].[CH2-]OCC(=O)[O-].
What is the InChIKey of 2-methanidyloxyacetate;methanolate?
The InChIKey is DOJMDSGJPHEMBV-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5O3.CH3O/c1-6-2-3(4)5;1-2/h1-2H2,(H,4,5);1H3/q2*-1/p-1.
What are the key properties of 2-methanidyloxyacetate;methanolate?
2-methanidyloxyacetate;methanolate has a molecular weight of 119.10 g/mol, XLogP of -2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidyloxyacetate;methanolate is sourced from PubChem (CID 90717089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).