About cadmium(2+);bis(2-ethoxyacetate)
cadmium(2+);bis(2-ethoxyacetate) (PubChem CID 87930337) has the molecular formula C8H14CdO6
and a molecular weight of 318.61 g/mol. Its IUPAC name is cadmium(2+);bis(2-ethoxyacetate).
Molecular Properties
| Compound Name | cadmium(2+);bis(2-ethoxyacetate) |
| PubChem CID | 87930337 |
| Molecular Formula | C8H14CdO6 |
| Molecular Weight | 318.61 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | cadmium(2+);bis(2-ethoxyacetate) |
| SMILES | CCOCC(=O)[O-].CCOCC(=O)[O-].[Cd+2] |
| InChI | InChI=1S/2C4H8O3.Cd/c2*1-2-7-3-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | FLQJOPODGBWDQD-UHFFFAOYSA-L |
| XLogP | -2.46 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.61 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cadmium(2+);bis(2-ethoxyacetate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis(2-ethoxyacetate)?
The IUPAC name of cadmium(2+);bis(2-ethoxyacetate) (CID 87930337) is cadmium(2+);bis(2-ethoxyacetate).
What is the SMILES notation for cadmium(2+);bis(2-ethoxyacetate)?
The canonical SMILES for cadmium(2+);bis(2-ethoxyacetate) is CCOCC(=O)[O-].CCOCC(=O)[O-].[Cd+2].
What is the InChIKey of cadmium(2+);bis(2-ethoxyacetate)?
The InChIKey is FLQJOPODGBWDQD-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H8O3.Cd/c2*1-2-7-3-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2.
What are the key properties of cadmium(2+);bis(2-ethoxyacetate)?
cadmium(2+);bis(2-ethoxyacetate) has a molecular weight of 318.61 g/mol, XLogP of -2.46, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis(2-ethoxyacetate) is sourced from PubChem (CID 87930337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).