About magnesium;1-ethoxypropan-2-one;hydride
magnesium;1-ethoxypropan-2-one;hydride (PubChem CID 173062640) has the molecular formula C5H12MgO2
and a molecular weight of 128.45 g/mol. Its IUPAC name is magnesium;1-ethoxypropan-2-one;hydride.
Molecular Properties
| Compound Name | magnesium;1-ethoxypropan-2-one;hydride |
| PubChem CID | 173062640 |
| Molecular Formula | C5H12MgO2 |
| Molecular Weight | 128.45 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | magnesium;1-ethoxypropan-2-one;hydride |
| SMILES | CCOCC(C)=O.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C5H10O2.Mg.2H/c1-3-7-4-5(2)6;;;/h3-4H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | PSKFHYFEUWQPSH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.45 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze magnesium;1-ethoxypropan-2-one;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1-ethoxypropan-2-one;hydride?
The IUPAC name of magnesium;1-ethoxypropan-2-one;hydride (CID 173062640) is magnesium;1-ethoxypropan-2-one;hydride.
What is the SMILES notation for magnesium;1-ethoxypropan-2-one;hydride?
The canonical SMILES for magnesium;1-ethoxypropan-2-one;hydride is CCOCC(C)=O.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;1-ethoxypropan-2-one;hydride?
The InChIKey is PSKFHYFEUWQPSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.Mg.2H/c1-3-7-4-5(2)6;;;/h3-4H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of magnesium;1-ethoxypropan-2-one;hydride?
magnesium;1-ethoxypropan-2-one;hydride has a molecular weight of 128.45 g/mol, XLogP of 0.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1-ethoxypropan-2-one;hydride is sourced from PubChem (CID 173062640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).