About methoxyethane;1-methoxypropan-2-one
methoxyethane;1-methoxypropan-2-one (PubChem CID 159894285) has the molecular formula C7H16O3
and a molecular weight of 148.20 g/mol. Its IUPAC name is methoxyethane;1-methoxypropan-2-one.
Molecular Properties
| Compound Name | methoxyethane;1-methoxypropan-2-one |
| PubChem CID | 159894285 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | methoxyethane;1-methoxypropan-2-one |
| SMILES | CCOC.COCC(C)=O |
| InChI | InChI=1S/C4H8O2.C3H8O/c1-4(5)3-6-2;1-3-4-2/h3H2,1-2H3;3H2,1-2H3 |
| InChIKey | NVDKVQBGPMQQLR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methoxyethane;1-methoxypropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxyethane;1-methoxypropan-2-one?
The IUPAC name of methoxyethane;1-methoxypropan-2-one (CID 159894285) is methoxyethane;1-methoxypropan-2-one.
What is the SMILES notation for methoxyethane;1-methoxypropan-2-one?
The canonical SMILES for methoxyethane;1-methoxypropan-2-one is CCOC.COCC(C)=O.
What is the InChIKey of methoxyethane;1-methoxypropan-2-one?
The InChIKey is NVDKVQBGPMQQLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C3H8O/c1-4(5)3-6-2;1-3-4-2/h3H2,1-2H3;3H2,1-2H3.
What are the key properties of methoxyethane;1-methoxypropan-2-one?
methoxyethane;1-methoxypropan-2-one has a molecular weight of 148.20 g/mol, XLogP of 0.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxyethane;1-methoxypropan-2-one is sourced from PubChem (CID 159894285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).