C17H28O8 — CID 20715511
1,5-diethoxy-3,3-bis(2-ethoxyacetyl)pentane-2,4-dione (PubChem CID 20715511) has the molecular formula C17H28O8 and a molecular weight of 360.40 g/mol. Its IUPAC name is 1,5-diethoxy-3,3-bis(2-ethoxyacetyl)pentane-2,4-dione.
| Compound Name | 1,5-diethoxy-3,3-bis(2-ethoxyacetyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 20715511 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1,5-diethoxy-3,3-bis(2-ethoxyacetyl)pentane-2,4-dione |
| SMILES | CCOCC(=O)C(C(=O)COCC)(C(=O)COCC)C(=O)COCC |
| InChI | InChI=1S/C17H28O8/c1-5-22-9-13(18)17(14(19)10-23-6-2,15(20)11-24-7-3)16(21)12-25-8-4/h5-12H2,1-4H3 |
| InChIKey | OMSKXUKOEXAGTA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|